CAS 167026-90-6 is the registry number for 1-Iodononafluoro(3-methylbut-1-ene), cis/trans mix, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene (CAS 167026-90-6) is a chemical compound with the molecular formula C5F9I and a molecular weight of 357.94 g/mol. IUPAC name: 1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene. InChIKey: KVLZYXPNBHIUMY-UHFFFAOYSA-N.
| Molecular formula | C5F9I |
|---|---|
| Molecular weight | 357.94 g/mol |
| IUPAC name | 1,2,3,4,4,4-hexafluoro-1-iodo-3-(trifluoromethyl)but-1-ene |
| InChIKey | KVLZYXPNBHIUMY-UHFFFAOYSA-N |
| SMILES | C(=C(F)I)(C(C(F)(F)F)(C(F)(F)F)F)F |
Computed by PubChem (NCBI)