CAS 105812-73-5 appears in our catalog under these names: (trans-4-phenylpiperidin-3-yl)methanol, 97%, 4-Phenylpiperidin-3-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[(3R,4S)-4-phenylpiperidin-3-yl]methanol (CAS 105812-73-5) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(3R,4S)-4-phenylpiperidin-3-yl]methanol. InChIKey: CCYONUQTZTYVFP-VXGBXAGGSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(3R,4S)-4-phenylpiperidin-3-yl]methanol |
| InChIKey | CCYONUQTZTYVFP-VXGBXAGGSA-N |
| SMILES | C1CNC[C@@H]([C@H]1C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)