CAS 1807937-67-2 is the registry number for Rac-((3R,4R)-4-phenylpiperidin-3-yl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[(3S,4S)-4-phenylpiperidin-3-yl]methanol (CAS 1807937-67-2) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: [(3S,4S)-4-phenylpiperidin-3-yl]methanol. InChIKey: CCYONUQTZTYVFP-NWDGAFQWSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | [(3S,4S)-4-phenylpiperidin-3-yl]methanol |
| InChIKey | CCYONUQTZTYVFP-NWDGAFQWSA-N |
| SMILES | C1CNC[C@H]([C@H]1C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)