CAS 105888-45-7 appears in our catalog under these names: H-Gln-AMC, H–Gln–AMC, H-Gln-AMC hydrobromide salt. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)pentanediamide (CAS 105888-45-7) is a chemical compound with the molecular formula C15H17N3O4 and a molecular weight of 303.31 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)pentanediamide. InChIKey: VEPDWBJBPXVCEN-NSHDSACASA-N.
| Molecular formula | C15H17N3O4 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)pentanediamide |
| InChIKey | VEPDWBJBPXVCEN-NSHDSACASA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCC(=O)N)N |
Computed by PubChem (NCBI)