Products 2512217-82-0

CAS 2512217-82-0 is the registry number for Ethyl 5-(4-nitroso piperazin-1-yl)-1-benzofuran-2-carboxylate. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Ethyl 5-(4-nitrosopiperazin-1-yl)-1-benzofuran-2-carboxylate (CAS 2512217-82-0) is a chemical compound with the molecular formula C15H17N3O4 and a molecular weight of 303.31 g/mol. IUPAC name: ethyl 5-(4-nitrosopiperazin-1-yl)-1-benzofuran-2-carboxylate. InChIKey: VZSQOCJDKVAGSY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17N3O4
Molecular weight303.31 g/mol
IUPAC nameethyl 5-(4-nitrosopiperazin-1-yl)-1-benzofuran-2-carboxylate
InChIKeyVZSQOCJDKVAGSY-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCN(CC3)N=O

Computed by PubChem (NCBI)