Products 105920-65-8
CAS 105920-65-8 is the registry number for 7,9-Dioxo-8-azaspiro(4.5)decane-8-butanoic Acid. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butanoic acid (CAS 105920-65-8) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: 4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butanoic acid. InChIKey: UKJFWUUALLRWGV-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 4-(7,9-dioxo-8-azaspiro[4.5]decan-8-yl)butanoic acid |
| InChIKey | UKJFWUUALLRWGV-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C(=O)C2)CCCC(=O)O |
Computed by PubChem (NCBI)