CAS 105945-24-2 appears in our catalog under these names: 3-(4-Chlorophenoxy)aniline, 95-<97%, 3-(4-Chlorophenoxy)aniline 97%. Offered by: Hoffman Fine Chemicals, Ambeed. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-(4-chlorophenoxy)aniline (CAS 105945-24-2) is a chemical compound with the molecular formula C12H10ClNO and a molecular weight of 219.66 g/mol. IUPAC name: 3-(4-chlorophenoxy)aniline. InChIKey: ATJUNEXOAIZXKR-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-(4-chlorophenoxy)aniline |
| InChIKey | ATJUNEXOAIZXKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)