CAS 105957-88-8 is the registry number for 4-Benzyl-2-nitroaniline. Offered by: TRC. Available pack sizes: 1g.
4-benzyl-2-nitroaniline (CAS 105957-88-8) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 4-benzyl-2-nitroaniline. InChIKey: HIESYFWWUDRAPU-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 4-benzyl-2-nitroaniline |
| InChIKey | HIESYFWWUDRAPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)