CAS 106073-27-2 appears in our catalog under these names: 3-(Dimethylamino)-2-(methylsulfonyl)acrylonitrile, 97%, (2E)-3-(Dimethylamino)-2-(methylsulfonyl)acrylonitrile, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(E)-3-(dimethylamino)-2-methylsulfonylprop-2-enenitrile (CAS 106073-27-2) is a chemical compound with the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. IUPAC name: (E)-3-(dimethylamino)-2-methylsulfonylprop-2-enenitrile. InChIKey: YGCYQSVPXXQVCC-AATRIKPKSA-N.
| Molecular formula | C6H10N2O2S |
|---|---|
| Molecular weight | 174.22 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-2-methylsulfonylprop-2-enenitrile |
| InChIKey | YGCYQSVPXXQVCC-AATRIKPKSA-N |
| SMILES | CN(C)/C=C(\C#N)/S(=O)(=O)C |
Computed by PubChem (NCBI)