Products 1931958-05-2

CAS 1931958-05-2 is the registry number for Rac-(4s,6r)-6-methyl-2-thioxohexahydropyrimidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinane-4-carboxylic acid (CAS 1931958-05-2) is a chemical compound with the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. IUPAC name: (4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinane-4-carboxylic acid. InChIKey: GCRRQALGTLXDHL-DMTCNVIQSA-N.

Identity
Molecular formulaC6H10N2O2S
Molecular weight174.22 g/mol
IUPAC name(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinane-4-carboxylic acid
InChIKeyGCRRQALGTLXDHL-DMTCNVIQSA-N
SMILESC[C@@H]1C[C@H](NC(=S)N1)C(=O)O

Computed by PubChem (NCBI)