CAS 1060813-09-3 is the registry number for N-Boc 2-Iodo-4-fluoroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl N-(4-fluoro-2-iodophenyl)carbamate (CAS 1060813-09-3) is a chemical compound with the molecular formula C11H13FINO2 and a molecular weight of 337.13 g/mol. IUPAC name: tert-butyl N-(4-fluoro-2-iodophenyl)carbamate. InChIKey: RVFPJEXQORZVIR-UHFFFAOYSA-N.
| Molecular formula | C11H13FINO2 |
|---|---|
| Molecular weight | 337.13 g/mol |
| IUPAC name | tert-butyl N-(4-fluoro-2-iodophenyl)carbamate |
| InChIKey | RVFPJEXQORZVIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)F)I |
Computed by PubChem (NCBI)