CAS 1876444-72-2 appears in our catalog under these names: tert-Butyl (3-fluoro-2-iodophenyl)carbamate, 95+%, tert-Butyl N-(3-fluoro-2-iodophenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Tert-butyl N-(3-fluoro-2-iodophenyl)carbamate (CAS 1876444-72-2) is a chemical compound with the molecular formula C11H13FINO2 and a molecular weight of 337.13 g/mol. IUPAC name: tert-butyl N-(3-fluoro-2-iodophenyl)carbamate. InChIKey: RSCIBNJTUQCQBZ-UHFFFAOYSA-N.
| Molecular formula | C11H13FINO2 |
|---|---|
| Molecular weight | 337.13 g/mol |
| IUPAC name | tert-butyl N-(3-fluoro-2-iodophenyl)carbamate |
| InChIKey | RSCIBNJTUQCQBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC=C1)F)I |
Computed by PubChem (NCBI)