CAS 1060815-96-4 appears in our catalog under these names: 1-(4-(Trifluoromethyl)thiazol-2-yl)ethanone, 97%, 1-(4-(Trifluoromethyl)-1,3-thiazol-2-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanone (CAS 1060815-96-4) is a chemical compound with the molecular formula C6H4F3NOS and a molecular weight of 195.16 g/mol. IUPAC name: 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanone. InChIKey: VGGMVWKKEMAJJF-UHFFFAOYSA-N.
| Molecular formula | C6H4F3NOS |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanone |
| InChIKey | VGGMVWKKEMAJJF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CS1)C(F)(F)F |
Computed by PubChem (NCBI)