CAS 1060956-53-7 is the registry number for 4-Bromo-N-(1,1-dioxidotetrahydrothiophen-3-yl)-1H-pyrrole-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N-(1,1-dioxothiolan-3-yl)-1H-pyrrole-2-carboxamide (CAS 1060956-53-7) is a chemical compound with the molecular formula C9H11BrN2O3S and a molecular weight of 307.17 g/mol. IUPAC name: 4-bromo-N-(1,1-dioxothiolan-3-yl)-1H-pyrrole-2-carboxamide. InChIKey: QJCBXEKPKIYARK-UHFFFAOYSA-N.
| Molecular formula | C9H11BrN2O3S |
|---|---|
| Molecular weight | 307.17 g/mol |
| IUPAC name | 4-bromo-N-(1,1-dioxothiolan-3-yl)-1H-pyrrole-2-carboxamide |
| InChIKey | QJCBXEKPKIYARK-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC(=O)C2=CC(=CN2)Br |
Computed by PubChem (NCBI)