CAS 106139-94-0 is the registry number for 6-Bromo-1H-phenalene, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-1H-phenalene (CAS 106139-94-0) is a chemical compound with the molecular formula C13H9Br and a molecular weight of 245.11 g/mol. IUPAC name: 6-bromo-1H-phenalene. InChIKey: VOARYMMTZDSSDW-UHFFFAOYSA-N.
| Molecular formula | C13H9Br |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 6-bromo-1H-phenalene |
| InChIKey | VOARYMMTZDSSDW-UHFFFAOYSA-N |
| SMILES | C1C=CC2=CC=C(C3=CC=CC1=C23)Br |
Computed by PubChem (NCBI)