Products 1830346-63-8
CAS 1830346-63-8 is the registry number for 7H–Cycloprop(a)acenaphthylene， 3–bromo–6b，7a–dihydro–. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
8-bromotetracyclo[7.3.1.02,4.05,13]trideca-1(12),5(13),6,8,10-pentaene (CAS 1830346-63-8) is a chemical compound with the molecular formula C13H9Br and a molecular weight of 245.11 g/mol. IUPAC name: 8-bromotetracyclo[7.3.1.02,4.05,13]trideca-1(12),5(13),6,8,10-pentaene. InChIKey: FJFZIHOVCRWDFU-UHFFFAOYSA-N.
| Molecular formula | C13H9Br |
|---|---|
| Molecular weight | 245.11 g/mol |
| IUPAC name | 8-bromotetracyclo[7.3.1.02,4.05,13]trideca-1(12),5(13),6,8,10-pentaene |
| InChIKey | FJFZIHOVCRWDFU-UHFFFAOYSA-N |
| SMILES | C1C2C1C3=CC=CC4=C(C=CC2=C43)Br |
Computed by PubChem (NCBI)