CAS 1061996-80-2 appears in our catalog under these names: 6,7-Dimethyl-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid, 6,7-Dimethyl-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6,7-dimethyl-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid (CAS 1061996-80-2) is a chemical compound with the molecular formula C17H15NO2S and a molecular weight of 297.4 g/mol. IUPAC name: 6,7-dimethyl-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid. InChIKey: MUXAYGLSZQNZBR-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2S |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 6,7-dimethyl-2-(5-methylthiophen-2-yl)quinoline-4-carboxylic acid |
| InChIKey | MUXAYGLSZQNZBR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=NC3=C(C=C(C(=C3)C)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)