CAS 65037-62-9 is the registry number for N-Tosyl-3-vinylindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-ethenyl-1-(4-methylphenyl)sulfonylindole (CAS 65037-62-9) is a chemical compound with the molecular formula C17H15NO2S and a molecular weight of 297.4 g/mol. IUPAC name: 3-ethenyl-1-(4-methylphenyl)sulfonylindole. InChIKey: BVOYNRMPSBRSRR-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2S |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 3-ethenyl-1-(4-methylphenyl)sulfonylindole |
| InChIKey | BVOYNRMPSBRSRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C=C |
Computed by PubChem (NCBI)