Products 28035-71-4
CAS 28035-71-4 is the registry number for 9-Tosyl-1,4-dihydro-1,4-epiminonaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
11-(4-methylphenyl)sulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (CAS 28035-71-4) is a chemical compound with the molecular formula C17H15NO2S and a molecular weight of 297.4 g/mol. IUPAC name: 11-(4-methylphenyl)sulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene. InChIKey: RTCBNNPMSGTYRC-UHFFFAOYSA-N.
| Molecular formula | C17H15NO2S |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | 11-(4-methylphenyl)sulfonyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| InChIKey | RTCBNNPMSGTYRC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C3C=CC2C4=CC=CC=C34 |
Computed by PubChem (NCBI)