CAS 1062292-60-7 is the registry number for Olaparib Impurity 47. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(3-bromo-4-fluorophenyl)methyl]-2H-phthalazin-1-one (CAS 1062292-60-7) is a chemical compound with the molecular formula C15H10BrFN2O and a molecular weight of 333.15 g/mol. IUPAC name: 4-[(3-bromo-4-fluorophenyl)methyl]-2H-phthalazin-1-one. InChIKey: UQKMKEBJMBOLHX-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFN2O |
|---|---|
| Molecular weight | 333.15 g/mol |
| IUPAC name | 4-[(3-bromo-4-fluorophenyl)methyl]-2H-phthalazin-1-one |
| InChIKey | UQKMKEBJMBOLHX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=C(C=C3)F)Br |
Computed by PubChem (NCBI)