CAS 2647-50-9 appears in our catalog under these names: Flubromazepam, >95% (HPLC), Flubromazepam (1.0mg/ml in Methanol), Flubromazepam (7-Bromo-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one), Flubromazepam (7-Bromo-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one) 1.0 mg/ml in Methanol, 7-Bromo-5-(2-fluorophenyl)-1,3-dihydrobenzo(e)-1,4-diazepin-2-one. Offered by: TRC, LoGiCal, Biosynth. Available pack sizes: 100mg, 1g, 1x1ml, 10mg, 1ml, 5mg, 25mg.
7-bromo-5-(2-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 2647-50-9) is a chemical compound with the molecular formula C15H10BrFN2O and a molecular weight of 333.15 g/mol. IUPAC name: 7-bromo-5-(2-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: ZRKDDZBVSZLOFS-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFN2O |
|---|---|
| Molecular weight | 333.15 g/mol |
| IUPAC name | 7-bromo-5-(2-fluorophenyl)-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | ZRKDDZBVSZLOFS-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=C3F |
Computed by PubChem (NCBI)