CAS 1062555-91-2 is the registry number for 2,7–Bis–(4–Bromophen–1–yl)–9,9–Dimethyl–9H–Fluorene. Offered by: GLPBio. Available pack sizes: 1g, 5g.
2,7-bis(4-bromophenyl)-9,9-dimethylfluorene (CAS 1062555-91-2) is a chemical compound with the molecular formula C27H20Br2 and a molecular weight of 504.3 g/mol. IUPAC name: 2,7-bis(4-bromophenyl)-9,9-dimethylfluorene. InChIKey: WALDNJBHNDUKDF-UHFFFAOYSA-N.
| Molecular formula | C27H20Br2 |
|---|---|
| Molecular weight | 504.3 g/mol |
| IUPAC name | 2,7-bis(4-bromophenyl)-9,9-dimethylfluorene |
| InChIKey | WALDNJBHNDUKDF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CC=C(C=C3)Br)C4=C1C=C(C=C4)C5=CC=C(C=C5)Br)C |
Computed by PubChem (NCBI)