CAS 357645-37-5 is the registry number for 2,7–Dibromo–9,9–di–p–tolyl–9H–fluorene. Offered by: GLPBio. Available pack sizes: 10g.
2,7-dibromo-9,9-bis(4-methylphenyl)fluorene (CAS 357645-37-5) is a chemical compound with the molecular formula C27H20Br2 and a molecular weight of 504.3 g/mol. IUPAC name: 2,7-dibromo-9,9-bis(4-methylphenyl)fluorene. InChIKey: HPFNUQVVMXXYOV-UHFFFAOYSA-N.
| Molecular formula | C27H20Br2 |
|---|---|
| Molecular weight | 504.3 g/mol |
| IUPAC name | 2,7-dibromo-9,9-bis(4-methylphenyl)fluorene |
| InChIKey | HPFNUQVVMXXYOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)C5=CC=C(C=C5)C |
Computed by PubChem (NCBI)