CAS 106261-48-7 appears in our catalog under these names: Imatinib Impurity 20, 4-(4-Methylpiperazin-1-ylmethyl)benzoic Acid, 4–((4–Methylpiperazin–1–yl)methyl)benzoic acid, 4-((4-Methylpiperazin-1-yl)methyl)benzoic acid, 4-((4-Methylpiperazin-1-yl)methyl)benzoic acid, 95%, 95%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: on request, 1g, 2,5g, 250mg, 25g, 5g, 0,05kg, 0,1kg.
4-[(4-methylpiperazin-1-yl)methyl]benzoic acid (CAS 106261-48-7) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid. InChIKey: ZJUXJQSYXBYFFO-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid |
| InChIKey | ZJUXJQSYXBYFFO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)