CAS 1063625-86-4 appears in our catalog under these names: 4-Fluorophenylsulfur Pentafluoride, 4-Fluorophenylsulfur pentafluoride, 97%, 4-Fluoro(pentafluorosulfanyl)benzene, 4-Fluorophenylsulfur Pentafluoride, >95.0%(GC), P-Fluorophenylsulfur pentafluoride, 98%. Offered by: Chemat, AmBeed, Biosynth, TCI, Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 2000mg.
Pentafluoro-(4-fluorophenyl)-lambda6-sulfane (CAS 1063625-86-4) is a chemical compound with the molecular formula C6H4F6S and a molecular weight of 222.15 g/mol. IUPAC name: pentafluoro-(4-fluorophenyl)-lambda6-sulfane. InChIKey: MURGBRJOSPNBEL-UHFFFAOYSA-N.
| Molecular formula | C6H4F6S |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | pentafluoro-(4-fluorophenyl)-lambda6-sulfane |
| InChIKey | MURGBRJOSPNBEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)