CAS 1422-41-9 appears in our catalog under these names: 3-Fluorophenylsulfur pentafluoride, 95%, 3-Fluorophenylsulfur pentafluoride, 98%, 3-Fluorophenylsulphur pentafluoride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,25g.
Pentafluoro-(3-fluorophenyl)-lambda6-sulfane (CAS 1422-41-9) is a chemical compound with the molecular formula C6H4F6S and a molecular weight of 222.15 g/mol. IUPAC name: pentafluoro-(3-fluorophenyl)-lambda6-sulfane. InChIKey: BHSBZHVAWYGOQS-UHFFFAOYSA-N.
| Molecular formula | C6H4F6S |
|---|---|
| Molecular weight | 222.15 g/mol |
| IUPAC name | pentafluoro-(3-fluorophenyl)-lambda6-sulfane |
| InChIKey | BHSBZHVAWYGOQS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(F)(F)(F)(F)F)F |
Computed by PubChem (NCBI)