Products 1063712-33-3
CAS 1063712-33-3 appears in our catalog under these names: 2-(4-Bromo-3-chlorophenyl)-1,3-dioxolane, 95%, 2-(4-Bromo-3-chlorophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
2-(4-bromo-3-chlorophenyl)-1,3-dioxolane (CAS 1063712-33-3) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 2-(4-bromo-3-chlorophenyl)-1,3-dioxolane. InChIKey: SDRIAFMSTIFISP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 2-(4-bromo-3-chlorophenyl)-1,3-dioxolane |
| InChIKey | SDRIAFMSTIFISP-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)