CAS 1064078-37-0 is the registry number for Methyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate (CAS 1064078-37-0) is a chemical compound with the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. IUPAC name: methyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate. InChIKey: PGEIOIOBHIGEMT-RFZPGFLSSA-N.
| Molecular formula | C6H10FNO2 |
|---|---|
| Molecular weight | 147.15 g/mol |
| IUPAC name | methyl (2R,4R)-4-fluoropyrrolidine-2-carboxylate |
| InChIKey | PGEIOIOBHIGEMT-RFZPGFLSSA-N |
| SMILES | COC(=O)[C@H]1C[C@H](CN1)F |
Computed by PubChem (NCBI)