Products 106426-62-4
CAS 106426-62-4 appears in our catalog under these names: Bis(4-aminophenyl)-d12 Ether, 98 atom % D, min 98% Chemical Purity, 4,4'-Oxydianiline-d12, 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1 mg.
N,N,2,3,5,6-hexadeuterio-4-[2,3,5,6-tetradeuterio-4-(dideuterioamino)phenoxy]aniline (CAS 106426-62-4) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 212.31 g/mol. IUPAC name: N,N,2,3,5,6-hexadeuterio-4-[2,3,5,6-tetradeuterio-4-(dideuterioamino)phenoxy]aniline. InChIKey: HLBLWEWZXPIGSM-AZLBOOTHSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 212.31 g/mol |
| IUPAC name | N,N,2,3,5,6-hexadeuterio-4-[2,3,5,6-tetradeuterio-4-(dideuterioamino)phenoxy]aniline |
| InChIKey | HLBLWEWZXPIGSM-AZLBOOTHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N([2H])[2H])[2H])[2H])OC2=C(C(=C(C(=C2[2H])[2H])N([2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)