CAS 1064365-95-2 is the registry number for (E)-5-(3-Hydroxybenzylidene)-2-mercaptothiazol-4(5H)-one, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(5E)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1064365-95-2) is a chemical compound with the molecular formula C10H7NO2S2 and a molecular weight of 237.3 g/mol. IUPAC name: (5E)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: ZCQNEHSJTBPNPT-VMPITWQZSA-N.
| Molecular formula | C10H7NO2S2 |
|---|---|
| Molecular weight | 237.3 g/mol |
| IUPAC name | (5E)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | ZCQNEHSJTBPNPT-VMPITWQZSA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=C/2\C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)