CAS 37530-35-1 appears in our catalog under these names: (5E)-5-(3-Hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5h)-one, 95%, 5-(3-Hydroxybenzylidene)-rhodanine. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 1g, 5g, 250 mg, 50 mg, 100 mg.
(5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 37530-35-1) is a chemical compound with the molecular formula C10H7NO2S2 and a molecular weight of 237.3 g/mol. IUPAC name: (5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: ZCQNEHSJTBPNPT-YVMONPNESA-N.
| Molecular formula | C10H7NO2S2 |
|---|---|
| Molecular weight | 237.3 g/mol |
| IUPAC name | (5Z)-5-[(3-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | ZCQNEHSJTBPNPT-YVMONPNESA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=C\2/C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)