CAS 106485-23-8 is the registry number for (2E,4E)-5-(4-Fluorophenyl)penta-2,4-dienal, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2E,4E)-5-(4-fluorophenyl)penta-2,4-dienal (CAS 106485-23-8) is a chemical compound with the molecular formula C11H9FO and a molecular weight of 176.19 g/mol. IUPAC name: (2E,4E)-5-(4-fluorophenyl)penta-2,4-dienal. InChIKey: RJDFBVBPWYJKEG-ZPUQHVIOSA-N.
| Molecular formula | C11H9FO |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | (2E,4E)-5-(4-fluorophenyl)penta-2,4-dienal |
| InChIKey | RJDFBVBPWYJKEG-ZPUQHVIOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/C=C/C=O)F |
Computed by PubChem (NCBI)