CAS 853192-64-0 is the registry number for 1-Fluoro-6-methoxy-naphthalene, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
1-fluoro-6-methoxynaphthalene (CAS 853192-64-0) is a chemical compound with the molecular formula C11H9FO and a molecular weight of 176.19 g/mol. IUPAC name: 1-fluoro-6-methoxynaphthalene. InChIKey: WMHWQGOHUQTLNW-UHFFFAOYSA-N.
| Molecular formula | C11H9FO |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | 1-fluoro-6-methoxynaphthalene |
| InChIKey | WMHWQGOHUQTLNW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC=C2)F |
Computed by PubChem (NCBI)