CAS 106498-19-5 is the registry number for 3-(4-Chloro-2-fluorophenyl)-3-hydroxypropanenitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chloro-2-fluorophenyl)-3-hydroxypropanenitrile (CAS 106498-19-5) is a chemical compound with the molecular formula C9H7ClFNO and a molecular weight of 199.61 g/mol. IUPAC name: 3-(4-chloro-2-fluorophenyl)-3-hydroxypropanenitrile. InChIKey: MHFJBAWEKWIIEG-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFNO |
|---|---|
| Molecular weight | 199.61 g/mol |
| IUPAC name | 3-(4-chloro-2-fluorophenyl)-3-hydroxypropanenitrile |
| InChIKey | MHFJBAWEKWIIEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(CC#N)O |
Computed by PubChem (NCBI)