CAS 1394003-70-3 is the registry number for 6-Chloro-7-fluoro-3,4-dihydroisoquinolin-1(2H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one (CAS 1394003-70-3) is a chemical compound with the molecular formula C9H7ClFNO and a molecular weight of 199.61 g/mol. IUPAC name: 6-chloro-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: QVBCHARAZQZQNL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFNO |
|---|---|
| Molecular weight | 199.61 g/mol |
| IUPAC name | 6-chloro-7-fluoro-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | QVBCHARAZQZQNL-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=CC(=C(C=C21)Cl)F |
Computed by PubChem (NCBI)