CAS 1065073-97-3 is the registry number for N-Isopropyl 3-bromo-4-fluorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
3-bromo-4-fluoro-N-propan-2-ylbenzamide (CAS 1065073-97-3) is a chemical compound with the molecular formula C10H11BrFNO and a molecular weight of 260.10 g/mol. IUPAC name: 3-bromo-4-fluoro-N-propan-2-ylbenzamide. InChIKey: OSVMIZLXXGLNLT-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 3-bromo-4-fluoro-N-propan-2-ylbenzamide |
| InChIKey | OSVMIZLXXGLNLT-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)