CAS 2270911-61-8 is the registry number for 4-Bromo-2-fluoro-5,n,n-trimethyl-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-N,N,5-trimethylbenzamide (CAS 2270911-61-8) is a chemical compound with the molecular formula C10H11BrFNO and a molecular weight of 260.10 g/mol. IUPAC name: 4-bromo-2-fluoro-N,N,5-trimethylbenzamide. InChIKey: HKMZYESFYXAHGB-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO |
|---|---|
| Molecular weight | 260.10 g/mol |
| IUPAC name | 4-bromo-2-fluoro-N,N,5-trimethylbenzamide |
| InChIKey | HKMZYESFYXAHGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)C(=O)N(C)C |
Computed by PubChem (NCBI)