CAS 1065074-00-1 is the registry number for N-Cyclohexyl 3-bromo-4-fluorobenzamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
3-bromo-N-cyclohexyl-4-fluorobenzamide (CAS 1065074-00-1) is a chemical compound with the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. IUPAC name: 3-bromo-N-cyclohexyl-4-fluorobenzamide. InChIKey: MMIVSOVGVFUMDU-UHFFFAOYSA-N.
| Molecular formula | C13H15BrFNO |
|---|---|
| Molecular weight | 300.17 g/mol |
| IUPAC name | 3-bromo-N-cyclohexyl-4-fluorobenzamide |
| InChIKey | MMIVSOVGVFUMDU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)