Products 2270906-15-3
CAS 2270906-15-3 is the registry number for 2-(4-Bromo-2-fluoro-phenyl)-1-piperidin-1-yl-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-2-fluorophenyl)-1-piperidin-1-ylethanone (CAS 2270906-15-3) is a chemical compound with the molecular formula C13H15BrFNO and a molecular weight of 300.17 g/mol. IUPAC name: 2-(4-bromo-2-fluorophenyl)-1-piperidin-1-ylethanone. InChIKey: ZXFZFTOKERRRLT-UHFFFAOYSA-N.
| Molecular formula | C13H15BrFNO |
|---|---|
| Molecular weight | 300.17 g/mol |
| IUPAC name | 2-(4-bromo-2-fluorophenyl)-1-piperidin-1-ylethanone |
| InChIKey | ZXFZFTOKERRRLT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)CC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)