Products 1065074-53-4
CAS 1065074-53-4 is the registry number for Methyl 6,8-difluoro-4-oxo-1,4-dihydroquinoline-2-carboxylate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
Methyl 6,8-difluoro-4-oxo-1H-quinoline-2-carboxylate (CAS 1065074-53-4) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: methyl 6,8-difluoro-4-oxo-1H-quinoline-2-carboxylate. InChIKey: VNFFZRZFGCJZJY-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO3 |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | methyl 6,8-difluoro-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | VNFFZRZFGCJZJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=O)C2=C(N1)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)