CAS 1492636-87-9 is the registry number for 3-(2,5-Difluorophenyl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 1492636-87-9) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: WCCCBWDQPKXBLW-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO3 |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)-5-methyl-1,2-oxazole-4-carboxylic acid |
| InChIKey | WCCCBWDQPKXBLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)