CAS 1065074-95-4 is the registry number for 2-Acetamido-3-bromo-5-fluoropyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(3-bromo-5-fluoro-2-pyridinyl)acetamide (CAS 1065074-95-4) is a chemical compound with the molecular formula C7H6BrFN2O and a molecular weight of 233.04 g/mol. IUPAC name: N-(3-bromo-5-fluoro-2-pyridinyl)acetamide. InChIKey: GGDXFTPHNXSROV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | N-(3-bromo-5-fluoro-2-pyridinyl)acetamide |
| InChIKey | GGDXFTPHNXSROV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=N1)F)Br |
Computed by PubChem (NCBI)