CAS 635702-31-7 is the registry number for 4-Bromo-2-fluoro-n-hydroxybenzamidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-2-fluoro-N'-hydroxybenzenecarboximidamide (CAS 635702-31-7) is a chemical compound with the molecular formula C7H6BrFN2O and a molecular weight of 233.04 g/mol. IUPAC name: 4-bromo-2-fluoro-N'-hydroxybenzenecarboximidamide. InChIKey: ZLDXWHDTLLXDES-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFN2O |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 4-bromo-2-fluoro-N'-hydroxybenzenecarboximidamide |
| InChIKey | ZLDXWHDTLLXDES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=NO)N |
Computed by PubChem (NCBI)