Products 106551-67-1
CAS 106551-67-1 is the registry number for 2,5-Dioxo-1,2,5,6,7,8-hexahydroquinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carbonitrile (CAS 106551-67-1) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carbonitrile. InChIKey: GSAHGZPXIFULGM-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2,5-dioxo-1,6,7,8-tetrahydroquinoline-3-carbonitrile |
| InChIKey | GSAHGZPXIFULGM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C(=O)N2)C#N)C(=O)C1 |
Computed by PubChem (NCBI)