Products 106589-19-9

CAS 106589-19-9 is the registry number for 2-Iodo-3-(methoxycarbonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-iodo-3-methoxycarbonylbenzoic acid (CAS 106589-19-9) is a chemical compound with the molecular formula C9H7IO4 and a molecular weight of 306.05 g/mol. IUPAC name: 2-iodo-3-methoxycarbonylbenzoic acid. InChIKey: YCNZKJMADITTNK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7IO4
Molecular weight306.05 g/mol
IUPAC name2-iodo-3-methoxycarbonylbenzoic acid
InChIKeyYCNZKJMADITTNK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1I)C(=O)O

Computed by PubChem (NCBI)