Products 14449-07-1
CAS 14449-07-1 is the registry number for 3-(4-Hydroxy-3-iodophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3-iodophenylpyruvic acid is a phenylpyruvic acid derivative having an iodo substituent at the 3-position and a hydroxy substituent at positions 4. It is functionally related to a pyruvic acid. It is a conjugate acid of a 4-hydroxy-3-iodophenylpyruvate.
Source: ChEBI
| Molecular formula | C9H7IO4 |
|---|---|
| Molecular weight | 306.05 g/mol |
| IUPAC name | 3-(4-hydroxy-3-iodophenyl)-2-oxopropanoic acid |
| InChIKey | CDAHFUWPMGXLON-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C(=O)O)I)O |
Computed by PubChem (NCBI)