Products 1067189-44-9
CAS 1067189-44-9 is the registry number for ADX61623, 98.84%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg, 10mM/1mL.
N-[4-(2-cyanopropan-2-yl)phenyl]-3,4-dimethoxybenzamide (CAS 1067189-44-9) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: N-[4-(2-cyanopropan-2-yl)phenyl]-3,4-dimethoxybenzamide. InChIKey: REYHCHKAIWXIGI-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | N-[4-(2-cyanopropan-2-yl)phenyl]-3,4-dimethoxybenzamide |
| InChIKey | REYHCHKAIWXIGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)NC(=O)C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)