CAS 1067274-85-4 is the registry number for (2S,4R)-4-Mercaptopyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid (CAS 1067274-85-4) is a chemical compound with the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. IUPAC name: (2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid. InChIKey: OYNANFOWNSGDJL-DMTCNVIQSA-N.
| Molecular formula | C5H9NO2S |
|---|---|
| Molecular weight | 147.20 g/mol |
| IUPAC name | (2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid |
| InChIKey | OYNANFOWNSGDJL-DMTCNVIQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)S |
Computed by PubChem (NCBI)