CAS 171189-35-8 is the registry number for Cis-4-mercapto-l-proline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid (CAS 171189-35-8) is a chemical compound with the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. IUPAC name: (2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid. InChIKey: OYNANFOWNSGDJL-IMJSIDKUSA-N.
| Molecular formula | C5H9NO2S |
|---|---|
| Molecular weight | 147.20 g/mol |
| IUPAC name | (2S,4S)-4-sulfanylpyrrolidine-2-carboxylic acid |
| InChIKey | OYNANFOWNSGDJL-IMJSIDKUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)S |
Computed by PubChem (NCBI)