CAS 106736-05-4 appears in our catalog under these names: 4-Bromo-N-(2-methylphenyl)benzamide, 4-Bromo-n-(2-methylphenyl)benzamide, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
4-bromo-N-(2-methylphenyl)benzamide (CAS 106736-05-4) is a chemical compound with the molecular formula C14H12BrNO and a molecular weight of 290.15 g/mol. IUPAC name: 4-bromo-N-(2-methylphenyl)benzamide. InChIKey: PIZDKOVRDPXLQV-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO |
|---|---|
| Molecular weight | 290.15 g/mol |
| IUPAC name | 4-bromo-N-(2-methylphenyl)benzamide |
| InChIKey | PIZDKOVRDPXLQV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)